C20H23NO2 — CID 97270691
(2R)-1-(3,3-diphenylpiperidin-1-yl)-2-hydroxypropan-1-one (PubChem CID 97270691) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2R)-1-(3,3-diphenylpiperidin-1-yl)-2-hydroxypropan-1-one.
| Compound Name | (2R)-1-(3,3-diphenylpiperidin-1-yl)-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 97270691 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2R)-1-(3,3-diphenylpiperidin-1-yl)-2-hydroxypropan-1-one |
| SMILES | C[C@@H](O)C(=O)N1CCCC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c1-16(22)19(23)21-14-8-13-20(15-21,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-7,9-12,16,22H,8,13-15H2,1H3/t16-/m1/s1 |
| InChIKey | NMULYQSAZWFHPY-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |