C22H27ClN2O — CID 154900279
(3,3-diphenylpiperidin-1-yl)-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride (PubChem CID 154900279) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is (3,3-diphenylpiperidin-1-yl)-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride.
| Compound Name | (3,3-diphenylpiperidin-1-yl)-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154900279 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3,3-diphenylpiperidin-1-yl)-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride |
| SMILES | Cl.O=C([C@@H]1CCCN1)N1CCCC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H26N2O.ClH/c25-21(20-13-7-15-23-20)24-16-8-14-22(17-24,18-9-3-1-4-10-18)19-11-5-2-6-12-19;/h1-6,9-12,20,23H,7-8,13-17H2;1H/t20-;/m0./s1 |
| InChIKey | COGSQAGDYLHZNM-BDQAORGHSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |