C22H21N3O2 — CID 72928446
5-(3,3-diphenylpiperidine-1-carbonyl)-1H-pyrazin-2-one (PubChem CID 72928446) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-(3,3-diphenylpiperidine-1-carbonyl)-1H-pyrazin-2-one.
| Compound Name | 5-(3,3-diphenylpiperidine-1-carbonyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 72928446 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-(3,3-diphenylpiperidine-1-carbonyl)-1H-pyrazin-2-one |
| SMILES | O=C(c1c[nH]c(=O)cn1)N1CCCC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H21N3O2/c26-20-15-23-19(14-24-20)21(27)25-13-7-12-22(16-25,17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,14-15H,7,12-13,16H2,(H,24,26) |
| InChIKey | IRHSKQOREFHGRT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |