C18H23FN2O2 — CID 92634041
N-(cyclopropylmethyl)-1-[2-(4-fluorophenyl)-2-methylpropanoyl]azetidine-3-carboxamide (PubChem CID 92634041) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[2-(4-fluorophenyl)-2-methylpropanoyl]azetidine-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-[2-(4-fluorophenyl)-2-methylpropanoyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 92634041 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[2-(4-fluorophenyl)-2-methylpropanoyl]azetidine-3-carboxamide |
| SMILES | CC(C)(C(=O)N1CC(C(=O)NCC2CC2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN2O2/c1-18(2,14-5-7-15(19)8-6-14)17(23)21-10-13(11-21)16(22)20-9-12-3-4-12/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,20,22) |
| InChIKey | BHTOXEUTHMSBJS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |