C16H21FN2O — CID 120656354
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)-2-methylpropan-1-one (PubChem CID 120656354) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)-2-methylpropan-1-one.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 120656354 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(3-fluorophenyl)-2-methylpropan-1-one |
| SMILES | CC(C)(C(=O)N1C[C@H]2CNC[C@H]2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O/c1-16(2,13-4-3-5-14(17)6-13)15(20)19-9-11-7-18-8-12(11)10-19/h3-6,11-12,18H,7-10H2,1-2H3/t11-,12+ |
| InChIKey | PPWIPIDDKXBTSU-TXEJJXNPSA-N |
| XLogP | 1.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |