C17H24N2O — CID 170792929
1-[(1,5-dimethylindol-3-yl)methyl]-4-methylpiperidin-4-ol (PubChem CID 170792929) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[(1,5-dimethylindol-3-yl)methyl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[(1,5-dimethylindol-3-yl)methyl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 170792929 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[(1,5-dimethylindol-3-yl)methyl]-4-methylpiperidin-4-ol |
| SMILES | Cc1ccc2c(c1)c(CN1CCC(C)(O)CC1)cn2C |
| InChI | InChI=1S/C17H24N2O/c1-13-4-5-16-15(10-13)14(11-18(16)3)12-19-8-6-17(2,20)7-9-19/h4-5,10-11,20H,6-9,12H2,1-3H3 |
| InChIKey | YKOOYSJNAAAVDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |