C16H23N3 — CID 117185174
1-ethyl-5-methyl-3-(piperazin-1-ylmethyl)indole (PubChem CID 117185174) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-ethyl-5-methyl-3-(piperazin-1-ylmethyl)indole.
| Compound Name | 1-ethyl-5-methyl-3-(piperazin-1-ylmethyl)indole |
|---|---|
| PubChem CID | 117185174 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-ethyl-5-methyl-3-(piperazin-1-ylmethyl)indole |
| SMILES | CCn1cc(CN2CCNCC2)c2cc(C)ccc21 |
| InChI | InChI=1S/C16H23N3/c1-3-19-12-14(11-18-8-6-17-7-9-18)15-10-13(2)4-5-16(15)19/h4-5,10,12,17H,3,6-9,11H2,1-2H3 |
| InChIKey | SZHWLLQUPKPZBL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |