C18H28N4 — CID 83948925
2-[5-methyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]ethanamine (PubChem CID 83948925) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-[5-methyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]ethanamine.
| Compound Name | 2-[5-methyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]ethanamine |
|---|---|
| PubChem CID | 83948925 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2-[5-methyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]ethanamine |
| SMILES | Cc1ccc2c(c1)c(CCCN1CCNCC1)cn2CCN |
| InChI | InChI=1S/C18H28N4/c1-15-4-5-18-17(13-15)16(14-22(18)10-6-19)3-2-9-21-11-7-20-8-12-21/h4-5,13-14,20H,2-3,6-12,19H2,1H3 |
| InChIKey | RHJMULVZRJAPOP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |