C19H27N3O2 — CID 83947404
2-[5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]acetic acid (PubChem CID 83947404) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]acetic acid.
| Compound Name | 2-[5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83947404 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indol-1-yl]acetic acid |
| SMILES | Cc1cc2c(CCCN3CCNCC3)cn(CC(=O)O)c2cc1C |
| InChI | InChI=1S/C19H27N3O2/c1-14-10-17-16(4-3-7-21-8-5-20-6-9-21)12-22(13-19(23)24)18(17)11-15(14)2/h10-12,20H,3-9,13H2,1-2H3,(H,23,24) |
| InChIKey | CEBARSJWCCRYEE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |