C18H25N3O2 — CID 83947403
2-[5,6-dimethyl-3-(2-piperazin-1-ylethyl)indol-1-yl]acetic acid (PubChem CID 83947403) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[5,6-dimethyl-3-(2-piperazin-1-ylethyl)indol-1-yl]acetic acid.
| Compound Name | 2-[5,6-dimethyl-3-(2-piperazin-1-ylethyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83947403 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-[5,6-dimethyl-3-(2-piperazin-1-ylethyl)indol-1-yl]acetic acid |
| SMILES | Cc1cc2c(CCN3CCNCC3)cn(CC(=O)O)c2cc1C |
| InChI | InChI=1S/C18H25N3O2/c1-13-9-16-15(3-6-20-7-4-19-5-8-20)11-21(12-18(22)23)17(16)10-14(13)2/h9-11,19H,3-8,12H2,1-2H3,(H,22,23) |
| InChIKey | ACLSNVGGKJHBHZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |