About 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole
1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole (PubChem CID 83948856) has the molecular formula C21H33N3
and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole.
Molecular Properties
| Compound Name | 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
| PubChem CID | 83948856 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
| SMILES | CCCCn1cc(CCCN2CCNCC2)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H33N3/c1-4-5-11-24-16-19(7-6-10-23-12-8-22-9-13-23)20-14-17(2)18(3)15-21(20)24/h14-16,22H,4-13H2,1-3H3 |
| InChIKey | SOENFWTUAIKFLU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole?
The IUPAC name of 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole (CID 83948856) is 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole.
What is the SMILES notation for 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole?
The canonical SMILES for 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole is CCCCn1cc(CCCN2CCNCC2)c2cc(C)c(C)cc21.
What is the InChIKey of 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole?
The InChIKey is SOENFWTUAIKFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3/c1-4-5-11-24-16-19(7-6-10-23-12-8-22-9-13-23)20-14-17(2)18(3)15-21(20)24/h14-16,22H,4-13H2,1-3H3.
What are the key properties of 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole?
1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole has a molecular weight of 327.52 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole is sourced from PubChem (CID 83948856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).