C21H33N3 — CID 83948856
1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole (PubChem CID 83948856) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole.
| Compound Name | 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
|---|---|
| PubChem CID | 83948856 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 1-butyl-5,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
| SMILES | CCCCn1cc(CCCN2CCNCC2)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H33N3/c1-4-5-11-24-16-19(7-6-10-23-12-8-22-9-13-23)20-14-17(2)18(3)15-21(20)24/h14-16,22H,4-13H2,1-3H3 |
| InChIKey | SOENFWTUAIKFLU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |