C19H29N3 — CID 83948919
1-ethyl-4,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole (PubChem CID 83948919) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-ethyl-4,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole.
| Compound Name | 1-ethyl-4,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
|---|---|
| PubChem CID | 83948919 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-ethyl-4,6-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
| SMILES | CCn1cc(CCCN2CCNCC2)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C19H29N3/c1-4-22-14-17(6-5-9-21-10-7-20-8-11-21)19-16(3)12-15(2)13-18(19)22/h12-14,20H,4-11H2,1-3H3 |
| InChIKey | VAMRKFDIDIIRBL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |