C18H27N3 — CID 83948952
1-ethyl-5,7-dimethyl-3-(2-piperazin-1-ylethyl)indole (PubChem CID 83948952) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 1-ethyl-5,7-dimethyl-3-(2-piperazin-1-ylethyl)indole.
| Compound Name | 1-ethyl-5,7-dimethyl-3-(2-piperazin-1-ylethyl)indole |
|---|---|
| PubChem CID | 83948952 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 1-ethyl-5,7-dimethyl-3-(2-piperazin-1-ylethyl)indole |
| SMILES | CCn1cc(CCN2CCNCC2)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C18H27N3/c1-4-21-13-16(5-8-20-9-6-19-7-10-20)17-12-14(2)11-15(3)18(17)21/h11-13,19H,4-10H2,1-3H3 |
| InChIKey | MWMAASDRVRUVJV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |