C17H25N3 — CID 96679391
2,5,7-trimethyl-3-(2-piperazin-1-ylethyl)-1H-indole (PubChem CID 96679391) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2,5,7-trimethyl-3-(2-piperazin-1-ylethyl)-1H-indole.
| Compound Name | 2,5,7-trimethyl-3-(2-piperazin-1-ylethyl)-1H-indole |
|---|---|
| PubChem CID | 96679391 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2,5,7-trimethyl-3-(2-piperazin-1-ylethyl)-1H-indole |
| SMILES | Cc1cc(C)c2[nH]c(C)c(CCN3CCNCC3)c2c1 |
| InChI | InChI=1S/C17H25N3/c1-12-10-13(2)17-16(11-12)15(14(3)19-17)4-7-20-8-5-18-6-9-20/h10-11,18-19H,4-9H2,1-3H3 |
| InChIKey | RXGZCRGMCQICQY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|