C17H21ClN2O2 — CID 83947423
2-[6-chloro-5-methyl-3-(2-pyrrolidin-1-ylethyl)indol-1-yl]acetic acid (PubChem CID 83947423) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-[6-chloro-5-methyl-3-(2-pyrrolidin-1-ylethyl)indol-1-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-methyl-3-(2-pyrrolidin-1-ylethyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83947423 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[6-chloro-5-methyl-3-(2-pyrrolidin-1-ylethyl)indol-1-yl]acetic acid |
| SMILES | Cc1cc2c(CCN3CCCC3)cn(CC(=O)O)c2cc1Cl |
| InChI | InChI=1S/C17H21ClN2O2/c1-12-8-14-13(4-7-19-5-2-3-6-19)10-20(11-17(21)22)16(14)9-15(12)18/h8-10H,2-7,11H2,1H3,(H,21,22) |
| InChIKey | AZBKLKMOKVBNLN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |