C12H17ClN2 — CID 18933143
2-(1,5-dimethylindol-3-yl)ethanamine;hydrochloride (PubChem CID 18933143) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-(1,5-dimethylindol-3-yl)ethanamine;hydrochloride.
| Compound Name | 2-(1,5-dimethylindol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 18933143 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(1,5-dimethylindol-3-yl)ethanamine;hydrochloride |
| SMILES | Cc1ccc2c(c1)c(CCN)cn2C.Cl |
| InChI | InChI=1S/C12H16N2.ClH/c1-9-3-4-12-11(7-9)10(5-6-13)8-14(12)2;/h3-4,7-8H,5-6,13H2,1-2H3;1H |
| InChIKey | HYNOHCJIDZTQLB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |