C13H19N3 — CID 176928919
3-(2-aminoethyl)-N,N,5-trimethylindol-1-amine (PubChem CID 176928919) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N,N,5-trimethylindol-1-amine.
| Compound Name | 3-(2-aminoethyl)-N,N,5-trimethylindol-1-amine |
|---|---|
| PubChem CID | 176928919 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-(2-aminoethyl)-N,N,5-trimethylindol-1-amine |
| SMILES | Cc1ccc2c(c1)c(CCN)cn2N(C)C |
| InChI | InChI=1S/C13H19N3/c1-10-4-5-13-12(8-10)11(6-7-14)9-16(13)15(2)3/h4-5,8-9H,6-7,14H2,1-3H3 |
| InChIKey | FCFIEPSPFRKJJV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |