C13H18ClN3O — CID 155858615
2-[3-(2-aminoethyl)-5-methylindol-1-yl]acetamide;hydrochloride (PubChem CID 155858615) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)-5-methylindol-1-yl]acetamide;hydrochloride.
| Compound Name | 2-[3-(2-aminoethyl)-5-methylindol-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 155858615 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[3-(2-aminoethyl)-5-methylindol-1-yl]acetamide;hydrochloride |
| SMILES | Cc1ccc2c(c1)c(CCN)cn2CC(N)=O.Cl |
| InChI | InChI=1S/C13H17N3O.ClH/c1-9-2-3-12-11(6-9)10(4-5-14)7-16(12)8-13(15)17;/h2-3,6-7H,4-5,8,14H2,1H3,(H2,15,17);1H |
| InChIKey | WHWHXVIECPXCOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |