C20H20N2S — CID 138983603
3-(1,5-dimethylindol-3-yl)sulfanyl-1,5-dimethylindole (PubChem CID 138983603) has the molecular formula C20H20N2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-(1,5-dimethylindol-3-yl)sulfanyl-1,5-dimethylindole.
| Compound Name | 3-(1,5-dimethylindol-3-yl)sulfanyl-1,5-dimethylindole |
|---|---|
| PubChem CID | 138983603 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-(1,5-dimethylindol-3-yl)sulfanyl-1,5-dimethylindole |
| SMILES | Cc1ccc2c(c1)c(Sc1cn(C)c3ccc(C)cc13)cn2C |
| InChI | InChI=1S/C20H20N2S/c1-13-5-7-17-15(9-13)19(11-21(17)3)23-20-12-22(4)18-8-6-14(2)10-16(18)20/h5-12H,1-4H3 |
| InChIKey | JBMDVCRNDFHFNS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |