C14H18N2O — CID 168925957
1-(1,5-dimethylindol-3-yl)-2-(methylamino)propan-1-one (PubChem CID 168925957) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(1,5-dimethylindol-3-yl)-2-(methylamino)propan-1-one.
| Compound Name | 1-(1,5-dimethylindol-3-yl)-2-(methylamino)propan-1-one |
|---|---|
| PubChem CID | 168925957 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(1,5-dimethylindol-3-yl)-2-(methylamino)propan-1-one |
| SMILES | CNC(C)C(=O)c1cn(C)c2ccc(C)cc12 |
| InChI | InChI=1S/C14H18N2O/c1-9-5-6-13-11(7-9)12(8-16(13)4)14(17)10(2)15-3/h5-8,10,15H,1-4H3 |
| InChIKey | LQTKRNKMVLSVDH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |