C11H12N2O — CID 119084556
1,5-dimethylindole-3-carboxamide (PubChem CID 119084556) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 1,5-dimethylindole-3-carboxamide.
| Compound Name | 1,5-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 119084556 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 1,5-dimethylindole-3-carboxamide |
| SMILES | Cc1ccc2c(c1)c(C(N)=O)cn2C |
| InChI | InChI=1S/C11H12N2O/c1-7-3-4-10-8(5-7)9(11(12)14)6-13(10)2/h3-6H,1-2H3,(H2,12,14) |
| InChIKey | MJFNTJYSZLDVCN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |