About 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile
5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile (PubChem CID 59423880) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile.
Molecular Properties
| Compound Name | 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile |
| PubChem CID | 59423880 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile |
| SMILES | CC1CN(C(=O)CCC(C#N)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O/c1-17-14-23(15-17)20(24)12-13-21(16-22,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17H,12-15H2,1H3 |
| InChIKey | DJSOVGMKQZHPLZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile?
The IUPAC name of 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile (CID 59423880) is 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile.
What is the SMILES notation for 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile?
The canonical SMILES for 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile is CC1CN(C(=O)CCC(C#N)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile?
The InChIKey is DJSOVGMKQZHPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O/c1-17-14-23(15-17)20(24)12-13-21(16-22,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17H,12-15H2,1H3.
What are the key properties of 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile?
5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile has a molecular weight of 318.42 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylazetidin-1-yl)-5-oxo-2,2-diphenylpentanenitrile is sourced from PubChem (CID 59423880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).