C22H25N3S2 — CID 53234129
(3-cyano-3,3-diphenylpropyl) 1,4-diazepane-1-carbodithioate (PubChem CID 53234129) has the molecular formula C22H25N3S2 and a molecular weight of 395.60 g/mol. Its IUPAC name is (3-cyano-3,3-diphenylpropyl) 1,4-diazepane-1-carbodithioate.
| Compound Name | (3-cyano-3,3-diphenylpropyl) 1,4-diazepane-1-carbodithioate |
|---|---|
| PubChem CID | 53234129 |
| Molecular Formula | C22H25N3S2 |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3-cyano-3,3-diphenylpropyl) 1,4-diazepane-1-carbodithioate |
| SMILES | N#CC(CCSC(=S)N1CCCNCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3S2/c23-18-22(19-8-3-1-4-9-19,20-10-5-2-6-11-20)12-17-27-21(26)25-15-7-13-24-14-16-25/h1-6,8-11,24H,7,12-17H2 |
| InChIKey | SAMYHZNFDJWVST-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|