C22H27NS2 — CID 91216742
3,3-diphenylbutyl piperidine-1-carbodithioate (PubChem CID 91216742) has the molecular formula C22H27NS2 and a molecular weight of 369.60 g/mol. Its IUPAC name is 3,3-diphenylbutyl piperidine-1-carbodithioate.
| Compound Name | 3,3-diphenylbutyl piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 91216742 |
| Molecular Formula | C22H27NS2 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3,3-diphenylbutyl piperidine-1-carbodithioate |
| SMILES | CC(CCSC(=S)N1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NS2/c1-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)15-18-25-21(24)23-16-9-4-10-17-23/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3 |
| InChIKey | PEPFEKGGOKUZLS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|