C20H31N3O — CID 120994951
4-methyl-4-phenyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)pentan-1-one (PubChem CID 120994951) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-methyl-4-phenyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)pentan-1-one.
| Compound Name | 4-methyl-4-phenyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 120994951 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 4-methyl-4-phenyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)pentan-1-one |
| SMILES | CC(C)(CCC(=O)N1CCC(N2CCNCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H31N3O/c1-20(2,17-6-4-3-5-7-17)10-8-19(24)23-13-9-18(16-23)22-14-11-21-12-15-22/h3-7,18,21H,8-16H2,1-2H3 |
| InChIKey | ACXBRDSEKXOYMD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |