C19H26F3N3O — CID 120997643
1-(3-piperazin-1-ylpyrrolidin-1-yl)-3-[2-(trifluoromethyl)phenyl]butan-1-one (PubChem CID 120997643) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-(3-piperazin-1-ylpyrrolidin-1-yl)-3-[2-(trifluoromethyl)phenyl]butan-1-one.
| Compound Name | 1-(3-piperazin-1-ylpyrrolidin-1-yl)-3-[2-(trifluoromethyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 120997643 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-(3-piperazin-1-ylpyrrolidin-1-yl)-3-[2-(trifluoromethyl)phenyl]butan-1-one |
| SMILES | CC(CC(=O)N1CCC(N2CCNCC2)C1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H26F3N3O/c1-14(16-4-2-3-5-17(16)19(20,21)22)12-18(26)25-9-6-15(13-25)24-10-7-23-8-11-24/h2-5,14-15,23H,6-13H2,1H3 |
| InChIKey | FPJDTCVOQIAXOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |