C20H30N4O2 — CID 120995809
N-benzyl-N-[3-oxo-3-(3-piperazin-1-ylpyrrolidin-1-yl)propyl]acetamide (PubChem CID 120995809) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-benzyl-N-[3-oxo-3-(3-piperazin-1-ylpyrrolidin-1-yl)propyl]acetamide.
| Compound Name | N-benzyl-N-[3-oxo-3-(3-piperazin-1-ylpyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 120995809 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-benzyl-N-[3-oxo-3-(3-piperazin-1-ylpyrrolidin-1-yl)propyl]acetamide |
| SMILES | CC(=O)N(CCC(=O)N1CCC(N2CCNCC2)C1)Cc1ccccc1 |
| InChI | InChI=1S/C20H30N4O2/c1-17(25)23(15-18-5-3-2-4-6-18)12-8-20(26)24-11-7-19(16-24)22-13-9-21-10-14-22/h2-6,19,21H,7-16H2,1H3 |
| InChIKey | AFJLAGWVUZEHMZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |