C27H37N3O — CID 87829573
6-[(2-methyl-3-morpholin-4-ylbutan-2-yl)amino]-2,2-diphenylhexanenitrile (PubChem CID 87829573) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 6-[(2-methyl-3-morpholin-4-ylbutan-2-yl)amino]-2,2-diphenylhexanenitrile.
| Compound Name | 6-[(2-methyl-3-morpholin-4-ylbutan-2-yl)amino]-2,2-diphenylhexanenitrile |
|---|---|
| PubChem CID | 87829573 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 6-[(2-methyl-3-morpholin-4-ylbutan-2-yl)amino]-2,2-diphenylhexanenitrile |
| SMILES | CC(N1CCOCC1)C(C)(C)NCCCCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O/c1-23(30-18-20-31-21-19-30)26(2,3)29-17-11-10-16-27(22-28,24-12-6-4-7-13-24)25-14-8-5-9-15-25/h4-9,12-15,23,29H,10-11,16-21H2,1-3H3 |
| InChIKey | KIPCWHROEWWRIH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|