C24H26O3 — CID 139808221
3-tritylpentane-1,3,5-triol (PubChem CID 139808221) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-tritylpentane-1,3,5-triol.
| Compound Name | 3-tritylpentane-1,3,5-triol |
|---|---|
| PubChem CID | 139808221 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-tritylpentane-1,3,5-triol |
| SMILES | OCCC(O)(CCO)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O3/c25-18-16-23(27,17-19-26)24(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,25-27H,16-19H2 |
| InChIKey | NDHLHRAGQLXWOP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|