C23H30O3 — CID 20813241
2-phenylpropan-2-yl 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate (PubChem CID 20813241) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate.
| Compound Name | 2-phenylpropan-2-yl 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 20813241 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-phenylpropan-2-yl 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate |
| SMILES | CCC(CC(C)(C)C(=O)OC(C)(C)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H30O3/c1-6-17(18-12-14-20(24)15-13-18)16-22(2,3)21(25)26-23(4,5)19-10-8-7-9-11-19/h7-15,17,24H,6,16H2,1-5H3 |
| InChIKey | BYEDMGWYNYOQTN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |