C17H20O5 — CID 59360179
methyl 4-(1,3-dioxo-2-benzofuran-5-yl)-2,2-dimethylhexanoate (PubChem CID 59360179) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl 4-(1,3-dioxo-2-benzofuran-5-yl)-2,2-dimethylhexanoate.
| Compound Name | methyl 4-(1,3-dioxo-2-benzofuran-5-yl)-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 59360179 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl 4-(1,3-dioxo-2-benzofuran-5-yl)-2,2-dimethylhexanoate |
| SMILES | CCC(CC(C)(C)C(=O)OC)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C17H20O5/c1-5-10(9-17(2,3)16(20)21-4)11-6-7-12-13(8-11)15(19)22-14(12)18/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | XSAHQCMIBOTQFL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|