C20H24O4 — CID 118632879
(4-hydroxyphenyl) 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate (PubChem CID 118632879) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (4-hydroxyphenyl) 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate.
| Compound Name | (4-hydroxyphenyl) 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 118632879 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4-hydroxyphenyl) 4-(4-hydroxyphenyl)-2,2-dimethylhexanoate |
| SMILES | CCC(CC(C)(C)C(=O)Oc1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H24O4/c1-4-14(15-5-7-16(21)8-6-15)13-20(2,3)19(23)24-18-11-9-17(22)10-12-18/h5-12,14,21-22H,4,13H2,1-3H3 |
| InChIKey | OICHPMQKCISJHT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|