C20H28O7 — CID 54130789
dimethyl 2-[[4-(4-hydroxyphenyl)-2,2-dimethylhexanoyl]oxymethyl]propanedioate (PubChem CID 54130789) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is dimethyl 2-[[4-(4-hydroxyphenyl)-2,2-dimethylhexanoyl]oxymethyl]propanedioate.
| Compound Name | dimethyl 2-[[4-(4-hydroxyphenyl)-2,2-dimethylhexanoyl]oxymethyl]propanedioate |
|---|---|
| PubChem CID | 54130789 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | dimethyl 2-[[4-(4-hydroxyphenyl)-2,2-dimethylhexanoyl]oxymethyl]propanedioate |
| SMILES | CCC(CC(C)(C)C(=O)OCC(C(=O)OC)C(=O)OC)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H28O7/c1-6-13(14-7-9-15(21)10-8-14)11-20(2,3)19(24)27-12-16(17(22)25-4)18(23)26-5/h7-10,13,16,21H,6,11-12H2,1-5H3 |
| InChIKey | NUFGAMYTBWLPGK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|