C22H36ClNO4 — CID 158434881
2-(2,2-dimethylbutanoyloxy)ethyl 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)hexanoate chloride (PubChem CID 158434881) has the molecular formula C22H36ClNO4 and a molecular weight of 413.99 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)hexanoate chloride.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)hexanoate chloride |
|---|---|
| PubChem CID | 158434881 |
| Molecular Formula | C22H36ClNO4 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2,2-dimethyl-4-(1-methylpyridin-1-ium-4-yl)hexanoate chloride |
| SMILES | CCC(CC(C)(C)C(=O)OCCOC(=O)C(C)(C)CC)c1cc[n+](C)cc1.[Cl-] |
| InChI | InChI=1S/C22H36NO4.ClH/c1-8-17(18-10-12-23(7)13-11-18)16-22(5,6)20(25)27-15-14-26-19(24)21(3,4)9-2;/h10-13,17H,8-9,14-16H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | WCJSECLQGOWUFH-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|