C27H40N2O5S — CID 20823486
3-[4-(8-butoxy-7,7-dimethyl-8-oxo-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 20823486) has the molecular formula C27H40N2O5S and a molecular weight of 504.69 g/mol. Its IUPAC name is 3-[4-(8-butoxy-7,7-dimethyl-8-oxo-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-(8-butoxy-7,7-dimethyl-8-oxo-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20823486 |
| Molecular Formula | C27H40N2O5S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 3-[4-(8-butoxy-7,7-dimethyl-8-oxo-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCCCOC(=O)C(C)(C)CC(CC(CC)c1cc[n+](CCCS(=O)(=O)[O-])cc1)c1ccncc1 |
| InChI | InChI=1S/C27H40N2O5S/c1-5-7-18-34-26(30)27(3,4)21-25(23-9-13-28-14-10-23)20-22(6-2)24-11-16-29(17-12-24)15-8-19-35(31,32)33/h9-14,16-17,22,25H,5-8,15,18-21H2,1-4H3 |
| InChIKey | PRJUIFKDYKANCW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 100.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|