C13H18ClNO2 — CID 59741509
ethyl 4-chloro-2,2-dimethyl-4-pyridin-4-ylbutanoate (PubChem CID 59741509) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is ethyl 4-chloro-2,2-dimethyl-4-pyridin-4-ylbutanoate.
| Compound Name | ethyl 4-chloro-2,2-dimethyl-4-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 59741509 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | ethyl 4-chloro-2,2-dimethyl-4-pyridin-4-ylbutanoate |
| SMILES | CCOC(=O)C(C)(C)CC(Cl)c1ccncc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-4-17-12(16)13(2,3)9-11(14)10-5-7-15-8-6-10/h5-8,11H,4,9H2,1-3H3 |
| InChIKey | RUNICLMLEQDKSJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|