C38H51ClN4O5S — CID 159166280
3-[4-[7-[1-[2-(2-methoxyethoxy)ethyl]pyridin-1-ium-4-yl]-3,9-dipyridin-4-yldecan-5-yl]pyridin-1-ium-1-yl]propane-1-sulfonate chloride (PubChem CID 159166280) has the molecular formula C38H51ClN4O5S and a molecular weight of 711.37 g/mol. Its IUPAC name is 3-[4-[7-[1-[2-(2-methoxyethoxy)ethyl]pyridin-1-ium-4-yl]-3,9-dipyridin-4-yldecan-5-yl]pyridin-1-ium-1-yl]propane-1-sulfonate chloride.
| Compound Name | 3-[4-[7-[1-[2-(2-methoxyethoxy)ethyl]pyridin-1-ium-4-yl]-3,9-dipyridin-4-yldecan-5-yl]pyridin-1-ium-1-yl]propane-1-sulfonate chloride |
|---|---|
| PubChem CID | 159166280 |
| Molecular Formula | C38H51ClN4O5S |
| Molecular Weight | 711.37 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | 3-[4-[7-[1-[2-(2-methoxyethoxy)ethyl]pyridin-1-ium-4-yl]-3,9-dipyridin-4-yldecan-5-yl]pyridin-1-ium-1-yl]propane-1-sulfonate chloride |
| SMILES | CCC(CC(CC(CC(C)c1ccncc1)c1cc[n+](CCOCCOC)cc1)c1cc[n+](CCCS(=O)(=O)[O-])cc1)c1ccncc1.[Cl-] |
| InChI | InChI=1S/C38H51N4O5S.ClH/c1-4-32(34-8-16-40-17-9-34)29-38(36-10-19-41(20-11-36)18-5-27-48(43,44)45)30-37(28-31(2)33-6-14-39-15-7-33)35-12-21-42(22-13-35)23-24-47-26-25-46-3;/h6-17,19-22,31-32,37-38H,4-5,18,23-30H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | YUILJHSGSZAFKV-UHFFFAOYSA-M |
| XLogP | 2.69 |
| TPSA | 109.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|