C27H35N2O3S+ — CID 20823483
3-[4-(7-phenyl-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 20823483) has the molecular formula C27H35N2O3S+ and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-[4-(7-phenyl-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-(7-phenyl-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20823483 |
| Molecular Formula | C27H35N2O3S+ |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-[4-(7-phenyl-5-pyridin-4-yloctan-3-yl)pyridin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(CC(CC(C)c1ccccc1)c1ccncc1)c1cc[n+](CCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O3S/c1-3-23(26-12-17-29(18-13-26)16-7-19-33(30,31)32)21-27(25-10-14-28-15-11-25)20-22(2)24-8-5-4-6-9-24/h4-6,8-15,17-18,22-23,27H,3,7,16,19-21H2,1-2H3/p+1 |
| InChIKey | WYHGLWSNHAZBEG-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|