C32H44N2NaO5S+ — CID 157302763
sodium;4-butan-2-ylbenzenesulfonate;6-[4-(5-pyridin-4-ylhexan-3-yl)pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 157302763) has the molecular formula C32H44N2NaO5S+ and a molecular weight of 591.77 g/mol. Its IUPAC name is sodium;4-butan-2-ylbenzenesulfonate;6-[4-(5-pyridin-4-ylhexan-3-yl)pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | sodium;4-butan-2-ylbenzenesulfonate;6-[4-(5-pyridin-4-ylhexan-3-yl)pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 157302763 |
| Molecular Formula | C32H44N2NaO5S+ |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | sodium;4-butan-2-ylbenzenesulfonate;6-[4-(5-pyridin-4-ylhexan-3-yl)pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | CCC(C)c1ccc(S(=O)(=O)[O-])cc1.CCC(CC(C)c1ccncc1)c1cc[n+](CCCCCC(=O)O)cc1.[Na+] |
| InChI | InChI=1S/C22H30N2O2.C10H14O3S.Na/c1-3-19(17-18(2)20-8-12-23-13-9-20)21-10-15-24(16-11-21)14-6-4-5-7-22(25)26;1-3-8(2)9-4-6-10(7-5-9)14(11,12)13;/h8-13,15-16,18-19H,3-7,14,17H2,1-2H3;4-8H,3H2,1-2H3,(H,11,12,13);/q;;+1 |
| InChIKey | NRXQWMXWQFJCTF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|