methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate

C16H25NO3 — CID 65298635

IUPACmethyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate
SMILESCOC(=O)C(C)(C)CC(N)c1ccc(OC(C)C)cc1
InChIInChI=1S/C16H25NO3/c1-11(2)20-13-8-6-12(7-9-13)14(17)10-16(3,4)15(18)19-5/h6-9,11,14H,10,17H2,1-5H3
InChIKeyUTVCZAVHFBQTNK-UHFFFAOYSA-N
MW279.38 g/mol
LogP3.06
Rot. Bonds6

About methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate

methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate (PubChem CID 65298635) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate.

Molecular Properties

Compound Namemethyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate
PubChem CID65298635
Molecular FormulaC16H25NO3
Molecular Weight279.38 g/mol
Exact Mass279.18
IUPAC Namemethyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate
SMILESCOC(=O)C(C)(C)CC(N)c1ccc(OC(C)C)cc1
InChIInChI=1S/C16H25NO3/c1-11(2)20-13-8-6-12(7-9-13)14(17)10-16(3,4)15(18)19-5/h6-9,11,14H,10,17H2,1-5H3
InChIKeyUTVCZAVHFBQTNK-UHFFFAOYSA-N
XLogP3.06
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.38
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate?
The IUPAC name of methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate (CID 65298635) is methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate.
What is the SMILES notation for methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate?
The canonical SMILES for methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate is COC(=O)C(C)(C)CC(N)c1ccc(OC(C)C)cc1.
What is the InChIKey of methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate?
The InChIKey is UTVCZAVHFBQTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-11(2)20-13-8-6-12(7-9-13)14(17)10-16(3,4)15(18)19-5/h6-9,11,14H,10,17H2,1-5H3.
What are the key properties of methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate?
methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate has a molecular weight of 279.38 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-2,2-dimethyl-4-(4-propan-2-yloxyphenyl)butanoate is sourced from PubChem (CID 65298635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).