C15H26N2O — CID 116934759
4-methyl-1-(4-propan-2-yloxyphenyl)pentane-1,4-diamine (PubChem CID 116934759) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-methyl-1-(4-propan-2-yloxyphenyl)pentane-1,4-diamine.
| Compound Name | 4-methyl-1-(4-propan-2-yloxyphenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 116934759 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 4-methyl-1-(4-propan-2-yloxyphenyl)pentane-1,4-diamine |
| SMILES | CC(C)Oc1ccc(C(N)CCC(C)(C)N)cc1 |
| InChI | InChI=1S/C15H26N2O/c1-11(2)18-13-7-5-12(6-8-13)14(16)9-10-15(3,4)17/h5-8,11,14H,9-10,16-17H2,1-4H3 |
| InChIKey | QVJDHFRRRJEHTM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |