C21H18O2 — CID 102451950
(3R)-3-(3-hydroxyphenyl)-1,3-diphenylpropan-1-one (PubChem CID 102451950) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3R)-3-(3-hydroxyphenyl)-1,3-diphenylpropan-1-one.
| Compound Name | (3R)-3-(3-hydroxyphenyl)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 102451950 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3R)-3-(3-hydroxyphenyl)-1,3-diphenylpropan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)c1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C21H18O2/c22-19-13-7-12-18(14-19)20(16-8-3-1-4-9-16)15-21(23)17-10-5-2-6-11-17/h1-14,20,22H,15H2/t20-/m1/s1 |
| InChIKey | NFTZCOGOIFBITG-HXUWFJFHSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |