C29H26O5 — CID 175303137
2,4-bis(2-hydroxyphenyl)-1,5-bis(3-hydroxyphenyl)pentan-3-one (PubChem CID 175303137) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2,4-bis(2-hydroxyphenyl)-1,5-bis(3-hydroxyphenyl)pentan-3-one.
| Compound Name | 2,4-bis(2-hydroxyphenyl)-1,5-bis(3-hydroxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 175303137 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2,4-bis(2-hydroxyphenyl)-1,5-bis(3-hydroxyphenyl)pentan-3-one |
| SMILES | O=C(C(Cc1cccc(O)c1)c1ccccc1O)C(Cc1cccc(O)c1)c1ccccc1O |
| InChI | InChI=1S/C29H26O5/c30-21-9-5-7-19(15-21)17-25(23-11-1-3-13-27(23)32)29(34)26(24-12-2-4-14-28(24)33)18-20-8-6-10-22(31)16-20/h1-16,25-26,30-33H,17-18H2 |
| InChIKey | XAZSNLRSZGPJRV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |