C29H22F4O3 — CID 174790624
1,5-bis(3,5-difluorophenyl)-2,4-bis(2-hydroxyphenyl)pentan-3-one (PubChem CID 174790624) has the molecular formula C29H22F4O3 and a molecular weight of 494.48 g/mol. Its IUPAC name is 1,5-bis(3,5-difluorophenyl)-2,4-bis(2-hydroxyphenyl)pentan-3-one.
| Compound Name | 1,5-bis(3,5-difluorophenyl)-2,4-bis(2-hydroxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174790624 |
| Molecular Formula | C29H22F4O3 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 1,5-bis(3,5-difluorophenyl)-2,4-bis(2-hydroxyphenyl)pentan-3-one |
| SMILES | O=C(C(Cc1cc(F)cc(F)c1)c1ccccc1O)C(Cc1cc(F)cc(F)c1)c1ccccc1O |
| InChI | InChI=1S/C29H22F4O3/c30-19-9-17(10-20(31)15-19)13-25(23-5-1-3-7-27(23)34)29(36)26(24-6-2-4-8-28(24)35)14-18-11-21(32)16-22(33)12-18/h1-12,15-16,25-26,34-35H,13-14H2 |
| InChIKey | UTWHHPIICFLTPG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |