C31H28F2OS2 — CID 174373565
1,5-bis(3-fluorophenyl)-2,4-bis(4-methylsulfanylphenyl)pentan-3-one (PubChem CID 174373565) has the molecular formula C31H28F2OS2 and a molecular weight of 518.69 g/mol. Its IUPAC name is 1,5-bis(3-fluorophenyl)-2,4-bis(4-methylsulfanylphenyl)pentan-3-one.
| Compound Name | 1,5-bis(3-fluorophenyl)-2,4-bis(4-methylsulfanylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174373565 |
| Molecular Formula | C31H28F2OS2 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 1,5-bis(3-fluorophenyl)-2,4-bis(4-methylsulfanylphenyl)pentan-3-one |
| SMILES | CSc1ccc(C(Cc2cccc(F)c2)C(=O)C(Cc2cccc(F)c2)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C31H28F2OS2/c1-35-27-13-9-23(10-14-27)29(19-21-5-3-7-25(32)17-21)31(34)30(20-22-6-4-8-26(33)18-22)24-11-15-28(36-2)16-12-24/h3-18,29-30H,19-20H2,1-2H3 |
| InChIKey | WGQVSQPBHJLPDF-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |