C16H19O6PS — CID 22673883
[4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)butyl]phenyl]sulfanylphosphonic acid (PubChem CID 22673883) has the molecular formula C16H19O6PS and a molecular weight of 370.36 g/mol. Its IUPAC name is [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)butyl]phenyl]sulfanylphosphonic acid.
| Compound Name | [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)butyl]phenyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 22673883 |
| Molecular Formula | C16H19O6PS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)butyl]phenyl]sulfanylphosphonic acid |
| SMILES | CCC(c1ccc(O)cc1)C(O)c1cc(O)ccc1SP(=O)(O)O |
| InChI | InChI=1S/C16H19O6PS/c1-2-13(10-3-5-11(17)6-4-10)16(19)14-9-12(18)7-8-15(14)24-23(20,21)22/h3-9,13,16-19H,2H2,1H3,(H2,20,21,22) |
| InChIKey | JBBWHEIZKHPBFX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|