C16H20NO6P — CID 54197801
[3-hydroxy-2-[1-hydroxy-4-(4-hydroxyphenyl)butyl]anilino]phosphonic acid (PubChem CID 54197801) has the molecular formula C16H20NO6P and a molecular weight of 353.31 g/mol. Its IUPAC name is [3-hydroxy-2-[1-hydroxy-4-(4-hydroxyphenyl)butyl]anilino]phosphonic acid.
| Compound Name | [3-hydroxy-2-[1-hydroxy-4-(4-hydroxyphenyl)butyl]anilino]phosphonic acid |
|---|---|
| PubChem CID | 54197801 |
| Molecular Formula | C16H20NO6P |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [3-hydroxy-2-[1-hydroxy-4-(4-hydroxyphenyl)butyl]anilino]phosphonic acid |
| SMILES | O=P(O)(O)Nc1cccc(O)c1C(O)CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H20NO6P/c18-12-9-7-11(8-10-12)3-1-5-14(19)16-13(17-24(21,22)23)4-2-6-15(16)20/h2,4,6-10,14,18-20H,1,3,5H2,(H3,17,21,22,23) |
| InChIKey | PNBZQKWOJVJEAF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|