C11H18N2O — CID 67087005
4-[(4R)-4,5-diaminopentyl]phenol (PubChem CID 67087005) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-[(4R)-4,5-diaminopentyl]phenol.
| Compound Name | 4-[(4R)-4,5-diaminopentyl]phenol |
|---|---|
| PubChem CID | 67087005 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-[(4R)-4,5-diaminopentyl]phenol |
| SMILES | NC[C@H](N)CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H18N2O/c12-8-10(13)3-1-2-9-4-6-11(14)7-5-9/h4-7,10,14H,1-3,8,12-13H2/t10-/m1/s1 |
| InChIKey | RJRCJMSPORQMGQ-SNVBAGLBSA-N |
| XLogP | 1.00 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |