C16H19O6P — CID 70147900
[5-hydroxy-2-[1-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate (PubChem CID 70147900) has the molecular formula C16H19O6P and a molecular weight of 338.30 g/mol. Its IUPAC name is [5-hydroxy-2-[1-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate.
| Compound Name | [5-hydroxy-2-[1-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70147900 |
| Molecular Formula | C16H19O6P |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [5-hydroxy-2-[1-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate |
| SMILES | CCCC(c1cccc(O)c1)c1ccc(O)cc1OP(=O)(O)O |
| InChI | InChI=1S/C16H19O6P/c1-2-4-14(11-5-3-6-12(17)9-11)15-8-7-13(18)10-16(15)22-23(19,20)21/h3,5-10,14,17-18H,2,4H2,1H3,(H2,19,20,21) |
| InChIKey | NJODCYSBMXYWNA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|