C18H28BrF — CID 65427554
5-(1-bromodecyl)-2-fluoro-1,3-dimethylbenzene (PubChem CID 65427554) has the molecular formula C18H28BrF and a molecular weight of 343.32 g/mol. Its IUPAC name is 5-(1-bromodecyl)-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-(1-bromodecyl)-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 65427554 |
| Molecular Formula | C18H28BrF |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-(1-bromodecyl)-2-fluoro-1,3-dimethylbenzene |
| SMILES | CCCCCCCCCC(Br)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C18H28BrF/c1-4-5-6-7-8-9-10-11-17(19)16-12-14(2)18(20)15(3)13-16/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | FKJSWVGDTWSUOH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|